CAS 1261984-51-3

4′-Fluoro-3-hydroxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid

Description:

4′-Fluoro-3-hydroxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a trifluoromethyl group (-CF3) and a fluoro group (-F) on the biphenyl framework significantly influences its chemical properties, including its reactivity and polarity. The hydroxyl group (-OH) and carboxylic acid group (-COOH) contribute to its acidic nature and potential for hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit interesting biological activity due to its structural features, making it a candidate for various applications in pharmaceuticals or agrochemicals. Additionally, the trifluoromethyl group is known to enhance metabolic stability and lipophilicity, which can be advantageous in drug design. Overall, the unique combination of functional groups and the biphenyl core make this compound a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₈F₄O₃

InChI: InChI=1S/C14H8F4O3/c15-11-4-2-7(5-10(11)14(16,17)18)8-1-3-9(13(20)21)12(19)6-8/h1-6,19H,(H,20,21)

InChI key: InChIKey=YFQFBEXEXBSMLW-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1F)C2=CC(O)=C(C(O)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 4′-fluoro-3-hydroxy-3′-(trifluoromethyl)-
• 4′-Fluoro-3-hydroxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid