CAS 1261984-69-3

5-(5-Carboxy-3-thienyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid

Description:

5-(5-Carboxy-3-thienyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a thienyl group. This substance features multiple functional groups, including carboxylic acids, which contribute to its acidic properties and potential reactivity. The presence of the thienyl moiety introduces unique electronic and steric effects, influencing the compound's behavior in chemical reactions and its interactions with biological systems. The compound is likely to exhibit solubility in polar solvents due to its carboxylic acid groups, and it may participate in hydrogen bonding, enhancing its reactivity. Additionally, the presence of the keto group (6-oxo) suggests potential tautomeric forms, which can affect its stability and reactivity. Overall, this compound may have applications in medicinal chemistry or materials science, although specific uses would depend on further research into its biological activity and chemical properties.

Formula: C₁₁H₇NO₅S

InChI: InChI=1S/C11H7NO5S/c13-9-7(1-5(3-12-9)10(14)15)6-2-8(11(16)17)18-4-6/h1-4H,(H,12,13)(H,14,15)(H,16,17)

InChI key: InChIKey=KDEMYYKMWKABKH-UHFFFAOYSA-N

SMILES: O=C1C(=CC(C(O)=O)=CN1)C=2C=C(C(O)=O)SC2

Synonyms:

• 5-(5-Carboxy-3-thienyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-(5-carboxy-3-thienyl)-1,6-dihydro-6-oxo-