CAS 1261984-80-8

5-Amino-4′-formyl[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Amino-4′-formyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including an amino group (-NH2), a formyl group (-CHO), and a carboxylic acid group (-COOH), which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the amino group allows for potential interactions in biological systems, while the carboxylic acid can participate in acid-base reactions and form esters or amides. The formyl group introduces a reactive aldehyde functionality, making it useful for further chemical modifications. This compound may exhibit solubility in polar solvents due to its functional groups, and its structural characteristics suggest potential applications in dye chemistry, pharmaceuticals, or as a building block in organic synthesis. As with many organic compounds, its stability and reactivity can be influenced by environmental conditions such as pH and temperature.

Formula: C₁₄H₁₁NO₃

InChI: InChI=1S/C14H11NO3/c15-13-6-11(5-12(7-13)14(17)18)10-3-1-9(8-16)2-4-10/h1-8H,15H2,(H,17,18)

InChI key: InChIKey=FGVRRASNDGTCEE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(N)C1)C2=CC=C(C=O)C=C2

Synonyms:

• 5-Amino-4′-formyl[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 5-amino-4′-formyl-