
CAS 1261985-03-8
:4′-[(Ethylamino)carbonyl]-3′-fluoro-2-hydroxy[1,1′-biphenyl]-4-carboxylic acid
Description:
4′-[(Ethylamino)carbonyl]-3′-fluoro-2-hydroxy[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its complex biphenyl structure, which includes functional groups such as an ethylamino group, a carboxylic acid, and a hydroxy group. The presence of the fluoro substituent indicates that it has enhanced reactivity and potential biological activity, often influencing its pharmacological properties. This compound is likely to exhibit polar characteristics due to the hydroxyl and carboxylic acid groups, which can engage in hydrogen bonding, affecting its solubility in various solvents. The ethylamino group may contribute to its basicity and potential interactions with biological targets. Additionally, the biphenyl framework can provide stability and influence the compound's electronic properties. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C16H14FNO4
InChI:InChI=1S/C16H14FNO4/c1-2-18-15(20)12-6-3-9(7-13(12)17)11-5-4-10(16(21)22)8-14(11)19/h3-8,19H,2H2,1H3,(H,18,20)(H,21,22)
InChI key:InChIKey=KBGYITGBUFIIQX-UHFFFAOYSA-N
SMILES:OC1=C(C=CC(C(O)=O)=C1)C2=CC(F)=C(C(NCC)=O)C=C2
Synonyms:- 4′-[(Ethylamino)carbonyl]-3′-fluoro-2-hydroxy[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 4′-[(ethylamino)carbonyl]-3′-fluoro-2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.