
CAS 1261985-67-4
:2-[3-[(Methylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid
Description:
2-[3-[(Methylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261985-67-4, is a chemical compound that features a complex structure comprising a pyridine ring and a phenyl group with a methylamino carbonyl substituent. This compound is characterized by its carboxylic acid functional group, which contributes to its acidic properties. The presence of the methylamino group suggests potential for hydrogen bonding and interactions with biological systems, making it of interest in medicinal chemistry. The compound's molecular structure indicates it may exhibit specific reactivity patterns typical of both aromatic and heterocyclic compounds, potentially influencing its solubility and stability in various solvents. Additionally, the presence of multiple functional groups may allow for diverse chemical modifications, enhancing its utility in synthetic applications. Overall, this compound's unique structural features position it as a candidate for further research in pharmaceutical development and organic synthesis.
Formula:C14H12N2O3
InChI:InChI=1S/C14H12N2O3/c1-15-13(17)10-5-2-4-9(8-10)12-11(14(18)19)6-3-7-16-12/h2-8H,1H3,(H,15,17)(H,18,19)
InChI key:InChIKey=POMKFRDDGKCMLX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N=CC=C1)C2=CC(C(NC)=O)=CC=C2
Synonyms:- 2-[3-[(Methylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-[3-[(methylamino)carbonyl]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.