CymitQuimica logo

CAS 1261986-75-7

:

Methyl 3′-cyano-6-fluoro-5′-hydroxy[1,1′-biphenyl]-3-carboxylate

Description:
Methyl 3′-cyano-6-fluoro-5′-hydroxy[1,1′-biphenyl]-3-carboxylate is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with various functional groups. The presence of a cyano group (-CN) and a fluoro group (-F) indicates potential reactivity and polarity, while the hydroxy group (-OH) contributes to its solubility in polar solvents. The methyl ester functional group (-COOCH3) suggests that this compound may exhibit ester-like properties, including potential for hydrolysis under certain conditions. This compound may be of interest in pharmaceutical or agrochemical research due to its unique structural features, which could influence biological activity or chemical reactivity. Additionally, the presence of multiple substituents on the biphenyl ring can lead to diverse interactions with biological targets or other chemical species. Overall, the characteristics of this compound make it a candidate for further investigation in various chemical and biological applications.
Formula:C15H10FNO3
InChI:InChI=1S/C15H10FNO3/c1-20-15(19)10-2-3-14(16)13(7-10)11-4-9(8-17)5-12(18)6-11/h2-7,18H,1H3
InChI key:InChIKey=HFQBIUVEYDJFIH-UHFFFAOYSA-N
SMILES:FC=1C(C2=CC(C#N)=CC(O)=C2)=CC(C(OC)=O)=CC1
Synonyms:
  • Methyl 3′-cyano-6-fluoro-5′-hydroxy[1,1′-biphenyl]-3-carboxylate
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-cyano-6-fluoro-5′-hydroxy-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.