CymitQuimica logo

CAS 1261987-42-1

:

N-(3′-Formyl-4′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide

Description:
N-(3′-Formyl-4′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide is a chemical compound characterized by its unique structural features, which include a biphenyl moiety with a formyl group and a hydroxy group at specific positions. The presence of the methanesulfonamide functional group contributes to its potential as a sulfonamide derivative, which may exhibit various biological activities. This compound is likely to be a solid at room temperature, with solubility influenced by the polar sulfonamide group and the overall hydrophobic character of the biphenyl structure. Its functional groups suggest potential reactivity in organic synthesis, particularly in forming covalent bonds with nucleophiles. Additionally, the compound may exhibit properties such as antioxidant activity or serve as a precursor in the synthesis of more complex molecules. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is handled and utilized.
Formula:C14H13NO4S
InChI:InChI=1S/C14H13NO4S/c1-20(18,19)15-13-4-2-3-10(8-13)11-5-6-14(17)12(7-11)9-16/h2-9,15,17H,1H3
InChI key:InChIKey=ZTACZKZFKGSRPX-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1O)C2=CC(NS(C)(=O)=O)=CC=C2
Synonyms:
  • Methanesulfonamide, N-(3′-formyl-4′-hydroxy[1,1′-biphenyl]-3-yl)-
  • N-(3′-Formyl-4′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.