
CAS 1261987-61-4
:4-Chloro-3′-hydroxy-5′-methyl[1,1′-biphenyl]-3-carboxylic acid
Description:
4-Chloro-3′-hydroxy-5′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates its acidic properties, while the hydroxyl group (-OH) contributes to its potential as a phenolic compound, which can participate in hydrogen bonding and exhibit antioxidant activity. The chlorine substituent at the 4-position and the methyl group at the 5′-position on the biphenyl framework influence its chemical reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its structural features suggest potential applications in various fields, including materials science and medicinal chemistry. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature.
Formula:C14H11ClO3
InChI:InChI=1S/C14H11ClO3/c1-8-4-10(6-11(16)5-8)9-2-3-13(15)12(7-9)14(17)18/h2-7,16H,1H3,(H,17,18)
InChI key:InChIKey=JREBHGZNYNQTAQ-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(O)C1)C2=CC(C(O)=O)=C(Cl)C=C2
Synonyms:- 4-Chloro-3′-hydroxy-5′-methyl[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 4-chloro-3′-hydroxy-5′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.