CAS 1261988-17-3

2-[3-[(Cyclopropylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid

Description:

2-[3-[(Cyclopropylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid, with the CAS number 1261988-17-3, is a chemical compound that features a complex structure incorporating both a pyridine and a phenyl ring, along with a cyclopropylamino group. This compound is characterized by its carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the cyclopropylamino moiety suggests potential applications in medicinal chemistry, as cyclopropyl groups are often found in pharmacologically active compounds. The compound's structure may influence its solubility, stability, and interaction with biological targets, making it of interest in drug design and development. Additionally, the specific arrangement of functional groups can affect its binding affinity and selectivity towards certain receptors or enzymes. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, highlighting its potential utility in pharmaceutical research.

Formula: C₁₆H₁₄N₂O₃

InChI: InChI=1S/C16H14N2O3/c19-15(18-12-6-7-12)11-4-1-3-10(9-11)14-13(16(20)21)5-2-8-17-14/h1-5,8-9,12H,6-7H2,(H,18,19)(H,20,21)

InChI key: InChIKey=PBCZGDOJTXQQFU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N=CC=C1)C2=CC(C(NC3CC3)=O)=CC=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 2-[3-[(cyclopropylamino)carbonyl]phenyl]-
• 2-[3-[(Cyclopropylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid