
CAS 1261988-20-8
:2′-Chloro-5′-hydroxy-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
Description:
2′-Chloro-5′-hydroxy-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 2′ position and a trifluoromethyl group at the 5′ position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The hydroxyl group at the 5′ position and the carboxylic acid functional group at the 3 position enhance its reactivity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its trifluoromethyl group can also influence its electronic properties, potentially affecting its interactions with biological targets. Overall, the combination of these functional groups suggests that this compound could be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications and reactivity profile.
Formula:C14H8ClF3O3
InChI:InChI=1S/C14H8ClF3O3/c15-12-2-1-10(19)6-11(12)7-3-8(13(20)21)5-9(4-7)14(16,17)18/h1-6,19H,(H,20,21)
InChI key:InChIKey=XUATUDHGHNAANM-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(C(F)(F)F)=CC(C(O)=O)=C2)C=C(O)C=C1
Synonyms:- 2′-Chloro-5′-hydroxy-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 2′-chloro-5′-hydroxy-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.