
CAS 1261988-24-2
:5-Fluoro-2′,3′-dimethyl[1,1′-biphenyl]-3-ol
Description:
5-Fluoro-2′,3′-dimethyl[1,1′-biphenyl]-3-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position of the biphenyl framework contributes to its classification as an alcohol. The substitution of a fluorine atom at the 5-position and two methyl groups at the 2' and 3' positions introduces specific steric and electronic effects, influencing the compound's reactivity and potential applications. This compound may exhibit unique properties such as altered solubility, stability, and biological activity due to these substituents. It is important to note that compounds with similar structures can have diverse applications in pharmaceuticals, agrochemicals, or materials science, depending on their specific functional groups and overall molecular architecture. As with any chemical substance, safety data and handling precautions should be considered when working with 5-Fluoro-2′,3′-dimethyl[1,1′-biphenyl]-3-ol.
Formula:C14H13FO
InChI:InChI=1S/C14H13FO/c1-9-4-3-5-14(10(9)2)11-6-12(15)8-13(16)7-11/h3-8,16H,1-2H3
InChI key:InChIKey=JXRZAHQCWZMHTM-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(F)=CC(O)=C2)C=CC=C1C
Synonyms:- [1,1′-Biphenyl]-3-ol, 5-fluoro-2′,3′-dimethyl-
- 5-Fluoro-2′,3′-dimethyl[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.