CAS 1261988-41-3

2-Chloro-5-[3-chloro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid

Description:

2-Chloro-5-[3-chloro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. The presence of chlorine atoms and a methoxycarbonyl group contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic and polar functional groups. Its acidic nature is attributed to the carboxylic acid group, which can participate in hydrogen bonding and influence its interactions with other molecules. The compound may also exhibit biological activity, making it of interest for pharmaceutical research. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, the unique combination of functional groups in this compound suggests potential utility in various chemical applications, including as a building block in the synthesis of more complex molecules.

Formula: C₁₄H₉Cl₂NO₄

InChI: InChI=1S/C14H9Cl2NO4/c1-21-14(20)8-3-2-7(4-11(8)15)10-6-17-12(16)5-9(10)13(18)19/h2-6H,1H3,(H,18,19)

InChI key: InChIKey=RXNLSHDERCRJEF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=C(Cl)C1)C2=CC(Cl)=C(C(OC)=O)C=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-chloro-5-[3-chloro-4-(methoxycarbonyl)phenyl]-
• 2-Chloro-5-[3-chloro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid