
CAS 1261988-53-7
:4′-Chloro-3-fluoro-2′-methyl[1,1′-biphenyl]-4-ol
Description:
4′-Chloro-3-fluoro-2′-methyl[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) at the para position relative to the biphenyl linkage, contributing to its classification as a phenolic compound. The presence of chlorine and fluorine substituents at specific positions on the biphenyl framework influences its chemical reactivity and physical properties, such as solubility and boiling point. The methyl group at the 2' position adds to the compound's steric bulk and can affect its interactions in biological systems. This compound may exhibit interesting biological activities due to its structural features, making it of interest in fields such as medicinal chemistry and materials science. Its CAS number, 1261988-53-7, allows for easy identification and retrieval of information regarding its properties, safety data, and potential applications in various chemical contexts.
Formula:C13H10ClFO
InChI:InChI=1S/C13H10ClFO/c1-8-6-10(14)3-4-11(8)9-2-5-13(16)12(15)7-9/h2-7,16H,1H3
InChI key:InChIKey=KLOCGNHVVSGZJP-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(F)=C(O)C=C2)C=CC(Cl)=C1
Synonyms:- [1,1′-Biphenyl]-4-ol, 4′-chloro-3-fluoro-2′-methyl-
- 4′-Chloro-3-fluoro-2′-methyl[1,1′-biphenyl]-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.