CymitQuimica logo

CAS 1261988-68-4

:

3′-Fluoro-4′-hydroxy-2-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-Fluoro-4′-hydroxy-2-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The compound also features a methoxy group (-OCH₃) and a hydroxy group (-OH), which can influence its solubility and reactivity. The fluorine substituent at the 3′ position can enhance the compound's biological activity and lipophilicity, potentially affecting its interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C14H11FO4
InChI:InChI=1S/C14H11FO4/c1-19-13-9(3-2-4-10(13)14(17)18)8-5-6-12(16)11(15)7-8/h2-7,16H,1H3,(H,17,18)
InChI key:InChIKey=WRJVXWBYUAUYPQ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1C(O)=O)C2=CC(F)=C(O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-fluoro-4′-hydroxy-2-methoxy-
  • 3′-Fluoro-4′-hydroxy-2-methoxy[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.