CymitQuimica logo

CAS 1261988-84-4

:

3-(3-Hydroxyphenyl)-2(1H)-pyridinone

Description:
3-(3-Hydroxyphenyl)-2(1H)-pyridinone, also known by its CAS number 1261988-84-4, is an organic compound characterized by its pyridinone structure, which features a pyridine ring fused with a ketone and a hydroxyl-substituted phenyl group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. It may display biological activity, potentially acting as a chelating agent or influencing various biochemical pathways, making it of interest in medicinal chemistry and pharmacology. The presence of both the hydroxyl and pyridinone functionalities suggests potential applications in coordination chemistry, where it could interact with metal ions. Additionally, its structural features may contribute to its stability and reactivity, influencing its behavior in different chemical environments. Overall, 3-(3-Hydroxyphenyl)-2(1H)-pyridinone represents a versatile compound with potential applications in various fields, including drug development and materials science.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c13-9-4-1-3-8(7-9)10-5-2-6-12-11(10)14/h1-7,13H,(H,12,14)
InChI key:InChIKey=PRZCGCRTNSGNEM-UHFFFAOYSA-N
SMILES:O=C1C(C2=CC(O)=CC=C2)=CC=CN1
Synonyms:
  • 2(1H)-Pyridinone, 3-(3-hydroxyphenyl)-
  • 3-(3-Hydroxyphenyl)-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.