CAS 1261988-85-5

6-[3-(1-Pyrrolidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid

Description:

6-[3-(1-Pyrrolidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261988-85-5, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a pyrrolidinylcarbonyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate polarity. Its functional groups suggest it may engage in hydrogen bonding and other intermolecular interactions, which can influence its reactivity and biological activity. The presence of the pyrrolidinyl group may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the carboxylic acid functional group can participate in acid-base reactions, contributing to its potential applications in various chemical syntheses or as a biological agent. Overall, this compound's unique structural features position it as a candidate for further research in drug development and other chemical applications.

Formula: C₁₇H₁₆N₂O₃

InChI: InChI=1S/C17H16N2O3/c20-16(19-8-1-2-9-19)13-5-3-4-12(10-13)15-7-6-14(11-18-15)17(21)22/h3-7,10-11H,1-2,8-9H2,(H,21,22)

InChI key: InChIKey=MMQBLYDTBMBBII-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2=CC=C(C(O)=O)C=N2)N3CCCC3

Synonyms:

• 3-Pyridinecarboxylic acid, 6-[3-(1-pyrrolidinylcarbonyl)phenyl]-
• 6-[3-(1-Pyrrolidinylcarbonyl)phenyl]-3-pyridinecarboxylic acid