
CAS 1261989-07-4
:4-(1,2-Dihydro-2-oxo-4-pyridinyl)benzaldehyde
Description:
4-(1,2-Dihydro-2-oxo-4-pyridinyl)benzaldehyde is an organic compound characterized by its unique structure, which features a benzaldehyde moiety attached to a pyridine derivative. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential reactivity due to the presence of the aldehyde functional group and the carbonyl group in the pyridine ring. It may display moderate solubility in polar organic solvents, while its aromatic nature suggests stability under standard conditions. The compound could be of interest in medicinal chemistry due to its potential biological activity, as derivatives of pyridine and benzaldehyde are often explored for their pharmacological properties. Additionally, the presence of the dihydropyridine structure may contribute to its reactivity and interaction with biological targets. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 4-(1,2-Dihydro-2-oxo-4-pyridinyl)benzaldehyde represents a versatile structure for further research and application in various chemical contexts.
Formula:C12H9NO2
InChI:InChI=1S/C12H9NO2/c14-8-9-1-3-10(4-2-9)11-5-6-13-12(15)7-11/h1-8H,(H,13,15)
InChI key:InChIKey=AWXYBPGYRBWXDV-UHFFFAOYSA-N
SMILES:O=C1C=C(C=CN1)C2=CC=C(C=O)C=C2
Synonyms:- Benzaldehyde, 4-(1,2-dihydro-2-oxo-4-pyridinyl)-
- 4-(1,2-Dihydro-2-oxo-4-pyridinyl)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.