CymitQuimica logo

CAS 1261989-49-4

:

N-(4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)acetamide

Description:
N-(4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)acetamide, identified by its CAS number 1261989-49-4, is an organic compound characterized by its biphenyl structure, which features a hydroxyl group and a methoxy group on the aromatic rings. This compound exhibits properties typical of aromatic amides, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the hydroxyl and methoxy substituents suggests that it may engage in hydrogen bonding and exhibit polar characteristics, which can influence its reactivity and interaction with biological systems. Additionally, the acetamide functional group may impart specific biological activities, making it of interest in pharmaceutical research. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of compounds with therapeutic properties. Overall, the compound's unique structural features contribute to its chemical behavior and potential utility in various applications.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c1-10(17)16-13-5-3-4-11(8-13)12-6-7-14(18)15(9-12)19-2/h3-9,18H,1-2H3,(H,16,17)
InChI key:InChIKey=BKUNBTFKMKXINK-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C=C(C=CC1)C2=CC(OC)=C(O)C=C2
Synonyms:
  • N-(4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)acetamide
  • Acetamide, N-(4′-hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.