CAS 1261990-54-8

4-Chloro-4′-methoxy-3′-methyl[1,1′-biphenyl]-3-ol

Description:

4-Chloro-4′-methoxy-3′-methyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) at the 3-position of the biphenyl, contributing to its classification as a phenolic compound. The presence of a methoxy group (-OCH3) at the 4′ position and a chloro substituent (Cl) at the 4 position of the biphenyl enhances its chemical reactivity and solubility properties. The methyl group (-CH3) at the 3′ position adds to the steric bulk and can influence the compound's biological activity. This compound may exhibit various properties such as antioxidant activity, and its structural features suggest potential applications in pharmaceuticals or agrochemicals. Additionally, the presence of halogen and functional groups can affect its interaction with biological systems, making it of interest in medicinal chemistry and material science. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions.

Formula: C₁₄H₁₃ClO₂

InChI: InChI=1S/C14H13ClO2/c1-9-7-10(4-6-14(9)17-2)11-3-5-12(15)13(16)8-11/h3-8,16H,1-2H3

InChI key: InChIKey=PKVSVEFBKNFHQE-UHFFFAOYSA-N

SMILES: CC=1C=C(C=CC1OC)C2=CC(O)=C(Cl)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-ol, 4-chloro-4′-methoxy-3′-methyl-
• 4-Chloro-4′-methoxy-3′-methyl[1,1′-biphenyl]-3-ol