
CAS 1261990-82-2
:3′-Hydroxy-N,N-dimethyl-5′-(trifluoromethoxy)[1,1′-biphenyl]-4-carboxamide
Description:
3′-Hydroxy-N,N-dimethyl-5′-(trifluoromethoxy)[1,1′-biphenyl]-4-carboxamide is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with various functional groups. The presence of a hydroxyl group at the 3′ position and a trifluoromethoxy group at the 5′ position contributes to its unique chemical reactivity and potential biological activity. The dimethylamino group enhances its solubility and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of amides, such as hydrogen bonding capabilities, which can affect its stability and reactivity. Additionally, the trifluoromethoxy group may impart distinctive electronic properties, potentially influencing the compound's pharmacokinetics and pharmacodynamics. Overall, this substance may be of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific biological activities or therapeutic applications. Further studies would be necessary to elucidate its precise behavior and potential uses in various fields.
Formula:C16H14F3NO3
InChI:InChI=1S/C16H14F3NO3/c1-20(2)15(22)11-5-3-10(4-6-11)12-7-13(21)9-14(8-12)23-16(17,18)19/h3-9,21H,1-2H3
InChI key:InChIKey=SLPQQAQDIYGVIE-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=C(C=C(O)C1)C2=CC=C(C(N(C)C)=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxamide, 3′-hydroxy-N,N-dimethyl-5′-(trifluoromethoxy)-
- 3′-Hydroxy-N,N-dimethyl-5′-(trifluoromethoxy)[1,1′-biphenyl]-4-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.