CymitQuimica logo

CAS 1261991-34-7

:

4-[2-(Hydroxymethyl)phenyl]-3-pyridinecarboxylic acid

Description:
4-[2-(Hydroxymethyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261991-34-7, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenolic moiety. This compound features a hydroxymethyl group attached to the phenyl ring, contributing to its potential reactivity and solubility in various solvents. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a biochemical probe due to its ability to interact with biological systems. Additionally, the compound may exhibit specific physical properties such as melting point and solubility, which are influenced by its functional groups and overall molecular architecture. As with many organic compounds, its behavior in different environments, including stability and reactivity, can be significantly affected by pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c15-8-9-3-1-2-4-10(9)11-5-6-14-7-12(11)13(16)17/h1-7,15H,8H2,(H,16,17)
InChI key:InChIKey=SGFMKODSDYPOJM-UHFFFAOYSA-N
SMILES:C(O)C1=C(C=CC=C1)C=2C(C(O)=O)=CN=CC2
Synonyms:
  • 4-[2-(Hydroxymethyl)phenyl]-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 4-[2-(hydroxymethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.