
CAS 1261991-43-8
:3′-Acetyl-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid
Description:
3′-Acetyl-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an acetyl group and a hydroxyl group, contributing to its reactivity and potential applications in various chemical reactions. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may serve as a precursor for further chemical modifications. Its hydroxyl group enhances its solubility in polar solvents and may also influence its biological activity. The compound's unique structure may allow it to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and materials science. Additionally, the presence of multiple functional groups suggests potential for hydrogen bonding, which can affect its physical properties such as melting point and solubility. Overall, 3′-Acetyl-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C15H12O4
InChI:InChI=1S/C15H12O4/c1-9(16)10-3-2-4-11(5-10)12-6-13(15(18)19)8-14(17)7-12/h2-8,17H,1H3,(H,18,19)
InChI key:InChIKey=AKDAEVWRVYEVIL-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C=C(C=CC1)C2=CC(C(O)=O)=CC(O)=C2
Synonyms:- 3′-Acetyl-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 3′-acetyl-5-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.