CymitQuimica logo

CAS 1261991-56-3

:

6-(3-Ethoxyphenyl)-3-pyridinol

Description:
6-(3-Ethoxyphenyl)-3-pyridinol, identified by its CAS number 1261991-56-3, is a chemical compound that features a pyridine ring substituted with a phenyl group that has an ethoxy substituent. This compound typically exhibits characteristics common to pyridinol derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory properties, due to the presence of the pyridine nitrogen and hydroxyl group. The ethoxy group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The molecular structure suggests that it may participate in hydrogen bonding due to the hydroxyl group, affecting its reactivity and interactions with other molecules. Additionally, the compound's aromatic features contribute to its stability and potential for π-π stacking interactions. Overall, 6-(3-Ethoxyphenyl)-3-pyridinol is of interest in medicinal chemistry and may serve as a lead compound for further pharmacological studies.
Formula:C13H13NO2
InChI:InChI=1S/C13H13NO2/c1-2-16-12-5-3-4-10(8-12)13-7-6-11(15)9-14-13/h3-9,15H,2H2,1H3
InChI key:InChIKey=KPRWOIJBBTVACV-UHFFFAOYSA-N
SMILES:O(CC)C=1C=C(C=CC1)C2=CC=C(O)C=N2
Synonyms:
  • 6-(3-Ethoxyphenyl)-3-pyridinol
  • 3-Pyridinol, 6-(3-ethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.