
CAS 1261992-26-0
:2-Chloro-5-(3-fluoro-4-hydroxyphenyl)-3-pyridinecarboxylic acid
Description:
2-Chloro-5-(3-fluoro-4-hydroxyphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and various substituents that influence its chemical properties. The presence of a chlorine atom and a fluorine atom, along with a hydroxy group on the phenyl ring, contributes to its unique reactivity and potential biological activity. This compound may exhibit properties such as moderate solubility in polar solvents due to the carboxylic acid group, while the halogen substituents can enhance lipophilicity and influence interactions with biological targets. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it a versatile candidate for research in medicinal chemistry. As with many such compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H7ClFNO3
InChI:InChI=1S/C12H7ClFNO3/c13-11-8(12(17)18)3-7(5-15-11)6-1-2-10(16)9(14)4-6/h1-5,16H,(H,17,18)
InChI key:InChIKey=RFVCCIMPACWVTF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1Cl)C2=CC(F)=C(O)C=C2
Synonyms:- 3-Pyridinecarboxylic acid, 2-chloro-5-(3-fluoro-4-hydroxyphenyl)-
- 2-Chloro-5-(3-fluoro-4-hydroxyphenyl)-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.