CymitQuimica logo

CAS 1261992-68-0

:

3-(2-Chloro-5-hydroxyphenyl)-2(1H)-pyridinone

Description:
3-(2-Chloro-5-hydroxyphenyl)-2(1H)-pyridinone, identified by its CAS number 1261992-68-0, is a chemical compound characterized by its unique structural features, which include a pyridinone core and a substituted phenyl group. The presence of a chloro group and a hydroxy group on the phenyl ring contributes to its potential reactivity and solubility properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its molecular structure suggests that it could participate in hydrogen bonding due to the hydroxyl group, influencing its interactions in biological systems. Additionally, the chlorine substituent may affect the compound's lipophilicity and overall pharmacokinetic profile. As with many heterocyclic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(2-Chloro-5-hydroxyphenyl)-2(1H)-pyridinone represents a class of compounds that may have significant implications in medicinal chemistry and related fields.
Formula:C11H8ClNO2
InChI:InChI=1S/C11H8ClNO2/c12-10-4-3-7(14)6-9(10)8-2-1-5-13-11(8)15/h1-6,14H,(H,13,15)
InChI key:InChIKey=FXLVABAINHYGFO-UHFFFAOYSA-N
SMILES:ClC1=C(C=C(O)C=C1)C=2C(=O)NC=CC2
Synonyms:
  • 2(1H)-Pyridinone, 3-(2-chloro-5-hydroxyphenyl)-
  • 3-(2-Chloro-5-hydroxyphenyl)-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.