CAS 1261993-00-3
:2-Fluoro-5-(3-thienyl)benzoic acid
Description:
2-Fluoro-5-(3-thienyl)benzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a fluorine atom and a thienyl group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The thienyl group, derived from thiophene, introduces heteroatoms into the structure, which can affect the compound's electronic properties and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. Additionally, the compound's potential applications could span various fields, including pharmaceuticals and agrochemicals, depending on its specific interactions and properties. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C11H7FO2S
InChI:InChI=1S/C11H7FO2S/c12-10-2-1-7(5-9(10)11(13)14)8-3-4-15-6-8/h1-6H,(H,13,14)
InChI key:InChIKey=CYISDRCRIVBKGS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1F)C=2C=CSC2
Synonyms:- Benzoic acid, 2-fluoro-5-(3-thienyl)-
- 2-Fluoro-5-(3-thienyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
