CAS 1261993-29-6

5-(2-Fluoro-3-methoxyphenyl)-3-pyridinecarboxylic acid

Description:

5-(2-Fluoro-3-methoxyphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding, influencing its solubility in polar solvents. The fluorine substituent may enhance lipophilicity and alter the compound's pharmacokinetic properties. Additionally, the methoxy group can affect the electronic distribution within the molecule, potentially impacting its interaction with biological targets. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Overall, the structural features of 5-(2-Fluoro-3-methoxyphenyl)-3-pyridinecarboxylic acid suggest it may possess interesting chemical and biological properties worthy of further investigation.

Formula: C₁₃H₁₀FNO₃

InChI: InChI=1S/C13H10FNO3/c1-18-11-4-2-3-10(12(11)14)8-5-9(13(16)17)7-15-6-8/h2-7H,1H3,(H,16,17)

InChI key: InChIKey=XHNYJFQRVVWHJW-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1OC)C=2C=C(C(O)=O)C=NC2

Synonyms:

• 5-(2-Fluoro-3-methoxyphenyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-(2-fluoro-3-methoxyphenyl)-