
CAS 1261993-67-2
:3-Methyl 4,6′-difluoro[1,1′-biphenyl]-3,3′-dicarboxylate
Description:
3-Methyl 4,6′-difluoro[1,1′-biphenyl]-3,3′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two carboxylate ester groups at the 3 and 3' positions contributes to its reactivity and potential applications in organic synthesis. The methyl group at the 3-position and the difluoro substituents at the 4 and 6' positions enhance its chemical properties, including polarity and solubility in various solvents. This compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine atoms, which can influence its behavior in chemical reactions and interactions with other molecules. Additionally, the presence of multiple functional groups suggests potential applications in pharmaceuticals, agrochemicals, or materials science. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorine, which can pose specific health and environmental risks.
Formula:C15H10F2O4
InChI:InChI=1S/C15H10F2O4/c1-21-15(20)11-6-8(2-4-13(11)17)10-7-9(14(18)19)3-5-12(10)16/h2-7H,1H3,(H,18,19)
InChI key:InChIKey=YUVVXHSRHUVAPQ-UHFFFAOYSA-N
SMILES:FC=1C(C2=CC(C(OC)=O)=C(F)C=C2)=CC(C(O)=O)=CC1
Synonyms:- 3-Methyl 4,6′-difluoro[1,1′-biphenyl]-3,3′-dicarboxylate
- [1,1′-Biphenyl]-3,3′-dicarboxylic acid, 4,6′-difluoro-, 3-methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.