
CAS 1261993-73-0
:4-(2,3-Difluorophenyl)-2(1H)-pyridinone
Description:
4-(2,3-Difluorophenyl)-2(1H)-pyridinone is an organic compound characterized by its unique structure, which includes a pyridinone core substituted with a difluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the pyridinone moiety. The difluorophenyl substituent can influence its electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. The presence of fluorine atoms often imparts unique characteristics, such as increased metabolic stability and altered solubility. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, 4-(2,3-Difluorophenyl)-2(1H)-pyridinone represents a class of compounds that may have significant applications in drug discovery and development.
Formula:C11H7F2NO
InChI:InChI=1S/C11H7F2NO/c12-9-3-1-2-8(11(9)13)7-4-5-14-10(15)6-7/h1-6H,(H,14,15)
InChI key:InChIKey=XCAMBZAVAYJTAF-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(=O)NC=C2)C=CC=C1F
Synonyms:- 4-(2,3-Difluorophenyl)-2(1H)-pyridinone
- 2(1H)-Pyridinone, 4-(2,3-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.