CAS 1261993-76-3

5-Fluoro-2′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Fluoro-2′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 5-position and a hydroxymethyl group at the 2′-position contributes to its unique reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 3-position provides acidic properties, making it soluble in polar solvents and reactive in various chemical reactions, such as esterification and amidation. This compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. Its specific applications could range from pharmaceuticals to agrochemicals, depending on its efficacy and safety profile. As with many organic compounds, the stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₁₄H₁₁FO₃

InChI: InChI=1S/C14H11FO3/c15-12-6-10(5-11(7-12)14(17)18)13-4-2-1-3-9(13)8-16/h1-7,16H,8H2,(H,17,18)

InChI key: InChIKey=LKBXPHPVWCSVID-UHFFFAOYSA-N

SMILES: C(O)C1=C(C=CC=C1)C2=CC(C(O)=O)=CC(F)=C2

Synonyms:

• 5-Fluoro-2′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-2′-(hydroxymethyl)-