
CAS 1261993-84-3
:3′,5′-Dichloro-3-nitro[1,1′-biphenyl]-4-carboxylic acid
Description:
3′,5′-Dichloro-3-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms and a nitro group at specific positions on the biphenyl framework contributes to its chemical reactivity and potential applications. The carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. This compound is likely to be of interest in fields such as agrochemicals or pharmaceuticals due to its potential biological activity. Additionally, the presence of halogen and nitro substituents can enhance its reactivity, making it a candidate for further chemical modifications. Safety and handling precautions should be observed, as compounds with halogen and nitro groups can pose environmental and health risks. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and application in synthetic chemistry.
Formula:C13H7Cl2NO4
InChI:InChI=1S/C13H7Cl2NO4/c14-9-3-8(4-10(15)6-9)7-1-2-11(13(17)18)12(5-7)16(19)20/h1-6H,(H,17,18)
InChI key:InChIKey=ACJBXZRQUIVNSI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1C(O)=O)C2=CC(Cl)=CC(Cl)=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxylic acid, 3′,5′-dichloro-3-nitro-
- 3′,5′-Dichloro-3-nitro[1,1′-biphenyl]-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.