CymitQuimica logo

CAS 1261993-91-2

:

5-(4-Chloro-3-methylphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid

Description:
5-(4-Chloro-3-methylphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro substituent and a methyl group on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic and heterocyclic components may influence its lipophilicity. The dihydro and keto functionalities suggest potential for tautomeric forms, which can affect its stability and reactivity. Additionally, the compound may possess pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its behavior in biological systems would require further investigation through pharmacological studies. Overall, this compound exemplifies the diversity of organic molecules with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H10ClNO3
InChI:InChI=1S/C13H10ClNO3/c1-7-4-8(2-3-11(7)14)10-6-15-12(16)5-9(10)13(17)18/h2-6H,1H3,(H,15,16)(H,17,18)
InChI key:InChIKey=PISGNVDKPAFKCG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CNC(=O)C1)C2=CC(C)=C(Cl)C=C2
Synonyms:
  • 5-(4-Chloro-3-methylphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid
  • 4-Pyridinecarboxylic acid, 5-(4-chloro-3-methylphenyl)-1,2-dihydro-2-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.