CymitQuimica logo

CAS 1261994-07-3

:

3′-[(Ethylamino)carbonyl]-5-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-[(Ethylamino)carbonyl]-5-methoxy[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an ethylamino group and a methoxy group, contributing to its unique chemical properties. The presence of carboxylic acid functional groups indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The ethylamino moiety suggests potential for hydrogen bonding, which can affect its reactivity and interactions with biological systems. Additionally, the methoxy group can enhance lipophilicity, impacting the compound's pharmacokinetics if considered for medicinal applications. Overall, this compound's structural features suggest it may have interesting biological activities, making it a candidate for further research in medicinal chemistry or related fields. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature references for precise characterization.
Formula:C17H17NO4
InChI:InChI=1S/C17H17NO4/c1-3-18-16(19)12-6-4-5-11(7-12)13-8-14(17(20)21)10-15(9-13)22-2/h4-10H,3H2,1-2H3,(H,18,19)(H,20,21)
InChI key:InChIKey=FBHZNRSVFCFKKT-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(OC)C1)C2=CC(C(NCC)=O)=CC=C2
Synonyms:
  • 3′-[(Ethylamino)carbonyl]-5-methoxy[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-[(ethylamino)carbonyl]-5-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.