CymitQuimica logo

CAS 1261995-00-9

:

2,2′-Difluoro-4′-methyl[1,1′-biphenyl]-4-ol

Description:
2,2′-Difluoro-4′-methyl[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 2' positions and a methyl group at the 4' position on one of the phenyl rings contributes to its unique chemical properties. The hydroxyl (-OH) group at the 4 position enhances its polarity, making it more soluble in polar solvents compared to non-polar solvents. This compound may exhibit interesting biological activities due to its structural features, potentially influencing its interaction with biological targets. Additionally, the fluorine substituents can affect the compound's electronic properties, stability, and reactivity, making it of interest in various fields, including medicinal chemistry and materials science. Its specific applications and behavior would depend on further studies, including its synthesis, reactivity, and potential uses in pharmaceuticals or as a chemical intermediate.
Formula:C13H10F2O
InChI:InChI=1S/C13H10F2O/c1-8-2-4-10(12(14)6-8)11-5-3-9(16)7-13(11)15/h2-7,16H,1H3
InChI key:InChIKey=KRJWQFSVOBPEPB-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C)=C1)C2=C(F)C=C(O)C=C2
Synonyms:
  • 2,2′-Difluoro-4′-methyl[1,1′-biphenyl]-4-ol
  • [1,1′-Biphenyl]-4-ol, 2,2′-difluoro-4′-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.