
CAS 1261995-01-0
:4′-Formyl-3′-hydroxy[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-Formyl-3′-hydroxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a formyl group (-CHO), a hydroxyl group (-OH), and a carboxylic acid group (-COOH) attached to the biphenyl framework, contributing to its reactivity and potential applications in organic synthesis and materials science. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents, acidity due to the carboxylic acid, and the ability to participate in hydrogen bonding due to the hydroxyl group. Additionally, the compound may display interesting optical properties, making it a candidate for studies in photochemistry or as a building block in the synthesis of more complex molecules. Its specific applications would depend on its reactivity and the ability to form derivatives through various chemical reactions.
Formula:C14H10O4
InChI:InChI=1S/C14H10O4/c15-8-12-5-4-10(7-13(12)16)9-2-1-3-11(6-9)14(17)18/h1-8,16H,(H,17,18)
InChI key:InChIKey=ABBHDWCERRWRGY-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1C=O)C2=CC(C(O)=O)=CC=C2
Synonyms:- 4′-Formyl-3′-hydroxy[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 4′-formyl-3′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.