CAS 1261995-59-8

2-Amino-5-(3-thienyl)-3-pyridinecarboxylic acid

Description:

2-Amino-5-(3-thienyl)-3-pyridinecarboxylic acid is an organic compound characterized by its heterocyclic structure, which includes both pyridine and thiophene rings. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The presence of the thienyl group, derived from thiophene, enhances its aromatic properties and may influence its reactivity and interactions in biological systems. The compound is likely to exhibit polar characteristics due to the functional groups, which can affect its solubility in various solvents. Additionally, the structural arrangement suggests potential for hydrogen bonding, which may play a role in its pharmacological properties. As a derivative of pyridinecarboxylic acid, it may also exhibit chelating abilities with metal ions, making it of interest in coordination chemistry. Overall, 2-Amino-5-(3-thienyl)-3-pyridinecarboxylic acid presents a unique combination of features that could be explored for applications in medicinal chemistry and materials science.

Formula: C₁₀H₈N₂O₂S

InChI: InChI=1S/C10H8N2O2S/c11-9-8(10(13)14)3-7(4-12-9)6-1-2-15-5-6/h1-5H,(H2,11,12)(H,13,14)

InChI key: InChIKey=YUDUZDZUAMQUPC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN=C1N)C=2C=CSC2

Synonyms:

• 2-Amino-5-(3-thienyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-amino-5-(3-thienyl)-