CymitQuimica logo

CAS 1261995-62-3

:

5-Fluoro-2-(5-formyl-2-thienyl)benzoic acid

Description:
5-Fluoro-2-(5-formyl-2-thienyl)benzoic acid is an organic compound characterized by its unique structural features, which include a benzoic acid moiety substituted with a fluoro group and a thienyl group that contains an aldehyde functional group. The presence of the fluoro substituent typically enhances the compound's reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The thienyl ring contributes to the compound's aromatic character and may also affect its solubility and interaction with biological targets. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or anticancer agents, due to the presence of both the aromatic and heterocyclic components. Additionally, its unique combination of functional groups may allow for further derivatization, expanding its utility in synthetic organic chemistry.
Formula:C12H7FO3S
InChI:InChI=1S/C12H7FO3S/c13-7-1-3-9(10(5-7)12(15)16)11-4-2-8(6-14)17-11/h1-6H,(H,15,16)
InChI key:InChIKey=QFWWOGVFVURKQO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(F)=C1)C=2SC(C=O)=CC2
Synonyms:
  • Benzoic acid, 5-fluoro-2-(5-formyl-2-thienyl)-
  • 5-Fluoro-2-(5-formyl-2-thienyl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.