CymitQuimica logo

CAS 1261995-69-0

:

5-(3-Fluoro-5-hydroxyphenyl)-2-thiophenecarboxaldehyde

Description:
5-(3-Fluoro-5-hydroxyphenyl)-2-thiophenecarboxaldehyde is an organic compound characterized by its unique structural features, which include a thiophene ring and a phenolic moiety with a fluorine substituent. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as condensation and oxidation. The fluorine atom enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The hydroxyl group contributes to the compound's potential for hydrogen bonding, affecting its solubility and reactivity. Additionally, the thiophene ring is known for its electronic properties, which can be beneficial in applications such as organic electronics and photonics. Overall, this compound's combination of functional groups and heterocyclic structure suggests potential utility in pharmaceuticals, agrochemicals, and materials science, warranting further investigation into its properties and applications.
Formula:C11H7FO2S
InChI:InChI=1S/C11H7FO2S/c12-8-3-7(4-9(14)5-8)11-2-1-10(6-13)15-11/h1-6,14H
InChI key:InChIKey=UJSWKIJGCNFIOV-UHFFFAOYSA-N
SMILES:C(=O)C=1SC(=CC1)C2=CC(F)=CC(O)=C2
Synonyms:
  • 2-Thiophenecarboxaldehyde, 5-(3-fluoro-5-hydroxyphenyl)-
  • 5-(3-Fluoro-5-hydroxyphenyl)-2-thiophenecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.