CymitQuimica logo

CAS 1261995-88-3

:

3-(3,5-Difluorophenyl)-2(1H)-pyridinone

Description:
3-(3,5-Difluorophenyl)-2(1H)-pyridinone, identified by its CAS number 1261995-88-3, is a chemical compound characterized by its unique structural features, which include a pyridinone core substituted with a difluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the pyridinone moiety. The difluorophenyl substituent can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The presence of fluorine atoms often contributes to increased metabolic stability and altered pharmacokinetics. Additionally, the compound's solubility, melting point, and boiling point can vary based on its specific formulation and purity. Overall, 3-(3,5-Difluorophenyl)-2(1H)-pyridinone represents a class of compounds that may have significant applications in pharmaceuticals and agrochemicals.
Formula:C11H7F2NO
InChI:InChI=1S/C11H7F2NO/c12-8-4-7(5-9(13)6-8)10-2-1-3-14-11(10)15/h1-6H,(H,14,15)
InChI key:InChIKey=WAQSIOXISRYRIN-UHFFFAOYSA-N
SMILES:O=C1C(=CC=CN1)C2=CC(F)=CC(F)=C2
Synonyms:
  • 3-(3,5-Difluorophenyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 3-(3,5-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.