CymitQuimica logo

CAS 1261995-95-2

:

5-(3,5-Difluorophenyl)-3-pyridinol

Description:
5-(3,5-Difluorophenyl)-3-pyridinol is an organic compound characterized by its pyridine and phenyl functional groups, specifically featuring a pyridinol structure with a difluorophenyl substituent. The presence of the difluorophenyl group indicates that the compound has two fluorine atoms attached to the phenyl ring, which can significantly influence its chemical properties, including reactivity and polarity. The pyridinol moiety contributes to the compound's potential as a weak base due to the presence of the hydroxyl (-OH) group, which can participate in hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its molecular structure suggests potential applications in medicinal chemistry, where modifications to the phenyl and pyridine rings can lead to variations in biological activity and pharmacokinetics. Overall, 5-(3,5-Difluorophenyl)-3-pyridinol is a compound of interest due to its unique structural features and potential applications in various chemical and biological contexts.
Formula:C11H7F2NO
InChI:InChI=1S/C11H7F2NO/c12-9-1-7(2-10(13)4-9)8-3-11(15)6-14-5-8/h1-6,15H
InChI key:InChIKey=RXGDHJJXWCPFQA-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1)C=2C=C(O)C=NC2
Synonyms:
  • 5-(3,5-Difluorophenyl)-3-pyridinol
  • 3-Pyridinol, 5-(3,5-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.