CymitQuimica logo

CAS 1261996-27-3

:

6-(4-Hydroxyphenyl)-2-pyridinecarboxylic acid

Description:
6-(4-Hydroxyphenyl)-2-pyridinecarboxylic acid, also known by its CAS number 1261996-27-3, is an organic compound characterized by its pyridine and phenolic functional groups. This compound features a pyridine ring substituted at the 2-position with a carboxylic acid group and at the 6-position with a 4-hydroxyphenyl group. The presence of the hydroxyl group contributes to its potential as a phenolic antioxidant, while the carboxylic acid group may enhance its solubility in polar solvents. The molecular structure suggests that it may exhibit both acidic and hydrogen-bonding properties, making it potentially useful in various chemical reactions and applications, including pharmaceuticals and agrochemicals. Additionally, the compound may possess biological activity, which warrants further investigation into its pharmacological properties. Its synthesis typically involves multi-step organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity.
Formula:C12H9NO3
InChI:InChI=1S/C12H9NO3/c14-9-6-4-8(5-7-9)10-2-1-3-11(13-10)12(15)16/h1-7,14H,(H,15,16)
InChI key:InChIKey=VUGNKOYVTILUSA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NC(=CC=C1)C2=CC=C(O)C=C2
Synonyms:
  • 6-(4-Hydroxyphenyl)-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 6-(4-hydroxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.