CAS 1261996-62-6

3′-Chloro-5-fluoro-2′-methyl[1,1′-biphenyl]-3-ol

Description:

3′-Chloro-5-fluoro-2′-methyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) at the 3-position of the biphenyl moiety, contributing to its classification as a phenolic compound. The presence of chlorine and fluorine substituents at the 3′ and 5 positions, respectively, introduces unique electronic and steric properties, potentially influencing its reactivity and interactions with biological systems. The methyl group at the 2′ position adds to the compound's hydrophobic characteristics. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals. As with many halogenated compounds, it is essential to consider its environmental impact and stability under various conditions. Safety data and handling precautions should be observed due to the presence of halogens and the potential for biological activity.

Formula: C₁₃H₁₀ClFO

InChI: InChI=1S/C13H10ClFO/c1-8-12(3-2-4-13(8)14)9-5-10(15)7-11(16)6-9/h2-7,16H,1H3

InChI key: InChIKey=LKDCXDSJKWVXJZ-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(F)=CC(O)=C2)C=CC=C1Cl

Synonyms:

• [1,1′-Biphenyl]-3-ol, 3′-chloro-5-fluoro-2′-methyl-
• 3′-Chloro-5-fluoro-2′-methyl[1,1′-biphenyl]-3-ol