CAS 1261996-72-8

5-Hydroxy-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Hydroxy-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid, identified by its CAS number 1261996-72-8, is a chemical compound characterized by its biphenyl structure, which features a hydroxyl group and a carboxylic acid functional group. The presence of a pyrrolidinylsulfonyl moiety suggests that it may exhibit unique pharmacological properties, potentially influencing its solubility and reactivity. This compound is likely to be a solid at room temperature, with moderate to high polarity due to the functional groups present. Its molecular structure indicates potential applications in medicinal chemistry, possibly as a lead compound in drug development. The sulfonyl group may enhance interactions with biological targets, while the hydroxyl and carboxylic acid groups could participate in hydrogen bonding, affecting its bioavailability and pharmacokinetics. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied.

Formula: C₁₇H₁₇NO₅S

InChI: InChI=1S/C17H17NO5S/c19-15-9-13(8-14(10-15)17(20)21)12-4-3-5-16(11-12)24(22,23)18-6-1-2-7-18/h3-5,8-11,19H,1-2,6-7H2,(H,20,21)

InChI key: InChIKey=DIVNJIOPYJZKLW-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(=CC=C1)C2=CC(C(O)=O)=CC(O)=C2)N3CCCC3

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-hydroxy-3′-(1-pyrrolidinylsulfonyl)-
• 5-Hydroxy-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid