CAS 1261996-89-7

5-Nitro-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Nitro-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a nitro group, a carboxylic acid functional group, and a pyrrolidinylsulfonyl moiety. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid and nitro groups. The sulfonyl group can enhance the compound's polarity and influence its interactions with biological systems, making it of interest in medicinal chemistry. Its specific applications may vary, but compounds with similar structures are often investigated for their potential as pharmaceuticals or agrochemicals. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₆N₂O₆S

InChI: InChI=1S/C17H16N2O6S/c20-17(21)14-8-13(9-15(10-14)19(22)23)12-4-3-5-16(11-12)26(24,25)18-6-1-2-7-18/h3-5,8-11H,1-2,6-7H2,(H,20,21)

InChI key: InChIKey=BCGURELVNSCCMS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(N(=O)=O)C1)C2=CC(S(=O)(=O)N3CCCC3)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-nitro-3′-(1-pyrrolidinylsulfonyl)-
• 5-Nitro-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid