CymitQuimica logo

CAS 1261996-92-2

:

3′,6-Difluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid

Description:
3′,6-Difluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 3′ and 6 positions of the biphenyl moiety significantly influences its chemical properties, including its reactivity and polarity. The hydroxyl group at the 4′ position contributes to its potential as a hydrogen bond donor, enhancing solubility in polar solvents and affecting its interaction with biological systems. Additionally, the carboxylic acid functional group at the 3 position introduces acidity, allowing for proton donation in aqueous solutions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its unique combination of functional groups and fluorine substituents may also impart specific electronic and steric effects, influencing its behavior in various chemical reactions and applications.
Formula:C13H8F2O3
InChI:InChI=1S/C13H8F2O3/c14-10-3-1-8(13(17)18)5-9(10)7-2-4-12(16)11(15)6-7/h1-6,16H,(H,17,18)
InChI key:InChIKey=GREXCYHVCVGUKG-UHFFFAOYSA-N
SMILES:FC=1C(=CC(C(O)=O)=CC1)C2=CC(F)=C(O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′,6-difluoro-4′-hydroxy-
  • 3′,6-Difluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.