CymitQuimica logo

CAS 1261996-96-6

:

4′-Acetyl-6-chloro[1,1′-biphenyl]-3-carboxylic acid

Description:
4′-Acetyl-6-chloro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an acetyl group at the para position and a carboxylic acid group at the meta position relative to the chlorine substituent contributes to its chemical reactivity and potential applications. The chlorine atom introduces electronegativity, influencing the compound's polarity and solubility in various solvents. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, the presence of functional groups such as the carboxylic acid can facilitate hydrogen bonding, affecting its interactions in biological systems. Overall, 4′-Acetyl-6-chloro[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with potential implications in pharmaceuticals and materials science, warranting further investigation into its properties and applications.
Formula:C15H11ClO3
InChI:InChI=1S/C15H11ClO3/c1-9(17)10-2-4-11(5-3-10)13-8-12(15(18)19)6-7-14(13)16/h2-8H,1H3,(H,18,19)
InChI key:InChIKey=MLRNDBDMBCMULC-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(C(O)=O)=CC1)C2=CC=C(C(C)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 4′-acetyl-6-chloro-
  • 4′-Acetyl-6-chloro[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.