
CAS 1261997-21-0
:2′-Fluoro-3,5′-dimethoxy[1,1′-biphenyl]-4-ol
Description:
2′-Fluoro-3,5′-dimethoxy[1,1′-biphenyl]-4-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2′ position and two methoxy groups at the 3 and 5′ positions on one of the phenyl rings significantly influences its chemical properties, including its reactivity and solubility. The hydroxyl group (-OH) at the 4 position contributes to its potential as a phenolic compound, which can participate in hydrogen bonding and may exhibit antioxidant properties. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and biological activity. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C14H13FO3
InChI:InChI=1S/C14H13FO3/c1-17-10-4-5-12(15)11(8-10)9-3-6-13(16)14(7-9)18-2/h3-8,16H,1-2H3
InChI key:InChIKey=AYBGMDGALRLNPU-UHFFFAOYSA-N
SMILES:FC=1C(=CC(OC)=CC1)C2=CC(OC)=C(O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-ol, 2′-fluoro-3,5′-dimethoxy-
- 2′-Fluoro-3,5′-dimethoxy[1,1′-biphenyl]-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.