CymitQuimica logo

CAS 1261997-37-8

:

3′-Fluoro-3,4′-dimethoxy[1,1′-biphenyl]-4-ol

Description:
3′-Fluoro-3,4′-dimethoxy[1,1′-biphenyl]-4-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 3′ position and two methoxy groups at the 3 and 4′ positions on one of the phenyl rings contributes to its unique chemical properties. The hydroxyl group (-OH) at the 4 position enhances its polarity and potential for hydrogen bonding, which can influence its solubility and reactivity. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its molecular interactions can be influenced by the electron-withdrawing nature of the fluorine atom and the electron-donating characteristics of the methoxy groups. Overall, 3′-Fluoro-3,4′-dimethoxy[1,1′-biphenyl]-4-ol is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C14H13FO3
InChI:InChI=1S/C14H13FO3/c1-17-13-6-4-9(7-11(13)15)10-3-5-12(16)14(8-10)18-2/h3-8,16H,1-2H3
InChI key:InChIKey=MXXZISNSSMWLCM-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1O)C2=CC(F)=C(OC)C=C2
Synonyms:
  • 3′-Fluoro-3,4′-dimethoxy[1,1′-biphenyl]-4-ol
  • [1,1′-Biphenyl]-4-ol, 3′-fluoro-3,4′-dimethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.