CAS 1261997-51-6

2-(5-Formyl-3-thienyl)-4-pyridinecarboxylic acid

Description:

2-(5-Formyl-3-thienyl)-4-pyridinecarboxylic acid is an organic compound characterized by its unique structural features, which include a pyridine ring and a thienyl group. The presence of the formyl group indicates that it has an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit both acidic and polar characteristics due to the carboxylic acid functional group, which can participate in hydrogen bonding and influence its solubility in various solvents. The thienyl moiety may impart additional electronic properties, making it of interest in fields such as medicinal chemistry and materials science. Its specific interactions and reactivity can be influenced by the substituents on the aromatic rings, which may affect its behavior in chemical reactions and its potential biological activity. Overall, 2-(5-Formyl-3-thienyl)-4-pyridinecarboxylic acid represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₁H₇NO₃S

InChI: InChI=1S/C11H7NO3S/c13-5-9-3-8(6-16-9)10-4-7(11(14)15)1-2-12-10/h1-6H,(H,14,15)

InChI key: InChIKey=QMLCRSIVIIAJQT-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(=CS1)C2=CC(C(O)=O)=CC=N2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-(5-formyl-3-thienyl)-
• 2-(5-Formyl-3-thienyl)-4-pyridinecarboxylic acid