
CAS 1261997-79-8
:4′-Methyl 3′-fluoro[1,1′-biphenyl]-3,4′-dicarboxylate
Description:
4′-Methyl 3′-fluoro[1,1′-biphenyl]-3,4′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group at the 4′ position and a fluorine atom at the 3′ position introduces specific electronic and steric effects, influencing the compound's reactivity and physical properties. The dicarboxylate functional groups at the 3 and 4′ positions contribute to its acidity and potential for forming esters or amides. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic biphenyl core, while the carboxylate groups may enhance solubility in polar solvents. Its unique structure may also impart interesting optical properties, making it a candidate for applications in materials science or pharmaceuticals. As with many organic compounds, safety data should be consulted for handling and storage, as well as potential environmental impacts.
Formula:C15H11FO4
InChI:InChI=1S/C15H11FO4/c1-20-15(19)12-6-5-10(8-13(12)16)9-3-2-4-11(7-9)14(17)18/h2-8H,1H3,(H,17,18)
InChI key:InChIKey=QPIWMGGLBAIGKR-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C(OC)=O)C2=CC(C(O)=O)=CC=C2
Synonyms:- 4′-Methyl 3′-fluoro[1,1′-biphenyl]-3,4′-dicarboxylate
- [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 3′-fluoro-, 4′-methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.